| Quantity: | |
|---|---|
6020-87-7
bosschemical
6020-87-7
 Creatine monohydrate Basic information | |
| Product Name: | Creatine monohydrate |
| CAS: | 6020-87-7 |
| MF: | C4H11N3O3 |
| MW: | 149.15 |
| EINECS: | 611-954-8 |
| Mol File: | 6020-87-7.mol |
| Creatine monohydrate Chemical Properties | |
| Melting point | 292 °C (dec.)(lit.) |
| density | 0.55-0.64 g/cm3 |
| RTECS | MB7706000 |
| storage temp. | 2-8°C |
| solubility | slightly soluble in water, insoluble in ethanol and ether. |
| form | Crystalline Powder |
| color | White to yellow |
| Odor | Odorless |
| PH | 6.9 (10g/l, H2O, 20℃) |
| Water Solubility | 13 g/L (20 ºC) |
| Merck | 142,568 |
| BRN | 907175 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H9N3O2.H2O/c1-7(4(5)6)2-3(8)9;/h2H2,1H3,(H3,5,6)(H,8,9);1H2 |
| InChIKey | MEJYXFHCRXAUIL-UHFFFAOYSA-N |
| SMILES | N(C)(C(N)=N)CC(=O)O.O |
| LogP | -1.877 (est) |
| CAS DataBase Reference | 6020-87-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Creatine hydrate(6020-87-7) |
| Creatine monohydrate Basic information | |
| Product Name: | Creatine monohydrate |
| CAS: | 6020-87-7 |
| MF: | C4H11N3O3 |
| MW: | 149.15 |
| EINECS: | 611-954-8 |
| Mol File: | 6020-87-7.mol |
| Creatine monohydrate Chemical Properties | |
| Melting point | 292 °C (dec.)(lit.) |
| density | 0.55-0.64 g/cm3 |
| RTECS | MB7706000 |
| storage temp. | 2-8°C |
| solubility | slightly soluble in water, insoluble in ethanol and ether. |
| form | Crystalline Powder |
| color | White to yellow |
| Odor | Odorless |
| PH | 6.9 (10g/l, H2O, 20℃) |
| Water Solubility | 13 g/L (20 ºC) |
| Merck | 142,568 |
| BRN | 907175 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H9N3O2.H2O/c1-7(4(5)6)2-3(8)9;/h2H2,1H3,(H3,5,6)(H,8,9);1H2 |
| InChIKey | MEJYXFHCRXAUIL-UHFFFAOYSA-N |
| SMILES | N(C)(C(N)=N)CC(=O)O.O |
| LogP | -1.877 (est) |
| CAS DataBase Reference | 6020-87-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Creatine hydrate(6020-87-7) |
