| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Zerumbone is a monocyclic sesquiterpene compound isolated from the rhizome of Zingiberumbet Smith. Zerumbone effectively inhibits the activation of Epstein Barr virus with an IC50 of 0.14mM. Zerumbone has anti-cancer, antioxidant, anti-inflammatory, and anti proliferative effects. | |||||||||
471-05-6
bosschem
471-05-6
| zerumbone Basic information | |
| Product Name: | zerumbone |
| CAS: | 471-05-6 |
| MF: | C15H22O |
| MW: | 218.33 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 471-05-6.mol |
| zerumbone Chemical Properties | |
| Melting point | 67-69℃ |
| Boiling point | 321.6±42.0 °C(Predicted) |
| density | 0.887±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥10mg/mL |
| form | powder |
| color | white to off-white |
| SMILES | C1(=O)C=CC(C)(C)CC=C(C)CCC=C1C |c:8,t:2,13| |
| LogP | 4.168 (est) |


content is empty!