| Quantity: | |
|---|---|
479-66-3
Boss Chemical
479-66-3
| Fulvic acid Basic information | |
| Overview Sources Humic and Fulvic acid Physiochemical property Applications Reference | |
| Product Name: | Fulvic acid |
| CAS: | 479-66-3 |
| MF: | C14H12O8 |
| MW: | 308.24 |
| EINECS: | 610-395-7 |
| Mol File: | 479-66-3.mol |
| Fulvic acid Chemical Properties | |
| Melting point | 246 °C (decomp) |
| Boiling point | 661.0±55.0 °C(Predicted) |
| density | 1.79±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Chloroform: soluble; Methanol: soluble |
| pka | 2.18±0.40(Predicted) |
| form | A solid |
| color | Yellow |
| InChI | InChI=1S/C14H12O8/c1-14(20)3-8-5(4-21-14)11(16)9-7(22-8)2-6(15)12(17)10(9)13(18)19/h2,15,17,20H,3-4H2,1H3,(H,18,19) |
| InChIKey | FCYKAQOGGFGCMD-UHFFFAOYSA-N |
| SMILES | C12CC(O)(C)OCC=1C(=O)C1=C(C(O)=O)C(O)=C(O)C=C1O2 |
| CAS DataBase Reference | 479-66-3(CAS DataBase Reference) |
| EPA Substance Registry System | Fulvic acid (479-66-3) |
| Fulvic acid Basic information | |
| Overview Sources Humic and Fulvic acid Physiochemical property Applications Reference | |
| Product Name: | Fulvic acid |
| CAS: | 479-66-3 |
| MF: | C14H12O8 |
| MW: | 308.24 |
| EINECS: | 610-395-7 |
| Mol File: | 479-66-3.mol |
| Fulvic acid Chemical Properties | |
| Melting point | 246 °C (decomp) |
| Boiling point | 661.0±55.0 °C(Predicted) |
| density | 1.79±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Chloroform: soluble; Methanol: soluble |
| pka | 2.18±0.40(Predicted) |
| form | A solid |
| color | Yellow |
| InChI | InChI=1S/C14H12O8/c1-14(20)3-8-5(4-21-14)11(16)9-7(22-8)2-6(15)12(17)10(9)13(18)19/h2,15,17,20H,3-4H2,1H3,(H,18,19) |
| InChIKey | FCYKAQOGGFGCMD-UHFFFAOYSA-N |
| SMILES | C12CC(O)(C)OCC=1C(=O)C1=C(C(O)=O)C(O)=C(O)C=C1O2 |
| CAS DataBase Reference | 479-66-3(CAS DataBase Reference) |
| EPA Substance Registry System | Fulvic acid (479-66-3) |
