| Quantity: | |
|---|---|
5996-10-1
Boss Chemical
5996-10-1
| D-Glucose monohydrate Basic information | |
| Product Name: | D-Glucose monohydrate |
| CAS: | 1496309 |
| MF: | C6H14O7 |
| MW: | 198.17 |
| EINECS: | 611-920-2 |
| Mol File: | 5996-10-1.mol |
| D-Glucose monohydrate Chemical Properties | |
| Melting point | 83°C |
| density | 1.54 |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| color | Colorless crystals |
| Odor | Odorless |
| PH Range | 5.9 |
| Water Solubility | 1 g/1.1 ml water @ 250C |
| InChI | InChI=1/C6H12O6.H2O/c7-1-2-3(8)4(9)5(10)6(11)12-2;/h2-11H,1H2;1H2/t2-,3-,4+,5-,6+;/s3 |
| InChIKey | OSNSWKAZFASRNG-YDLLFKKHNA-N |
| SMILES | [C@H]1(CO)O[C@@H]([C@H](O)[C@@H](O)[C@@H]1O)O.O |&1:0,4,5,7,9,r| |
| CAS DataBase Reference | 5996-10-1(CAS DataBase Reference) |
| Items | Specification |
| Description | White, crystalline granules or as a granular powder |
| Identification | A copious red precipitate of cuprous oxide forms |
| Solubility | Freely soluble in water, very soluble in boiling water, |
| and slightly soluble in alcohol | |
| Assay | 99.5%-100.5% |
| Arsenic | ≤1mg/kg |
| Chlorides | ≤0.018% |
| Lead | ≤0.1mg/kg |
| Sulfur Dioxide | ≤0.001% |
| Loss on Drying | ≤10.0% |
| Optical (Specific) Rotation | +52.6°~+53.2° |
| Residue on Ignition | ≤0.1% |
| Starch | A yellow color indicates the absence of soluble starch |
| Heavy Metals | 5ppm max |
| Cadmium | 1ppm max |
| Mercury | 1ppm max |
| Granulation(particle size) | 100% pass 20mesh |
| Total Bacteria Count | ≤1,000cfu/g |
| Yeast and Mould | ≤100cfu/g |
| Coliforms | <1/g |
| E. coli | <1/g  |
| Salmonella | <1/25g |
| D-Glucose monohydrate Basic information | |
| Product Name: | D-Glucose monohydrate |
| CAS: | 1496309 |
| MF: | C6H14O7 |
| MW: | 198.17 |
| EINECS: | 611-920-2 |
| Mol File: | 5996-10-1.mol |
| D-Glucose monohydrate Chemical Properties | |
| Melting point | 83°C |
| density | 1.54 |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| color | Colorless crystals |
| Odor | Odorless |
| PH Range | 5.9 |
| Water Solubility | 1 g/1.1 ml water @ 250C |
| InChI | InChI=1/C6H12O6.H2O/c7-1-2-3(8)4(9)5(10)6(11)12-2;/h2-11H,1H2;1H2/t2-,3-,4+,5-,6+;/s3 |
| InChIKey | OSNSWKAZFASRNG-YDLLFKKHNA-N |
| SMILES | [C@H]1(CO)O[C@@H]([C@H](O)[C@@H](O)[C@@H]1O)O.O |&1:0,4,5,7,9,r| |
| CAS DataBase Reference | 5996-10-1(CAS DataBase Reference) |
| Items | Specification |
| Description | White, crystalline granules or as a granular powder |
| Identification | A copious red precipitate of cuprous oxide forms |
| Solubility | Freely soluble in water, very soluble in boiling water, |
| and slightly soluble in alcohol | |
| Assay | 99.5%-100.5% |
| Arsenic | ≤1mg/kg |
| Chlorides | ≤0.018% |
| Lead | ≤0.1mg/kg |
| Sulfur Dioxide | ≤0.001% |
| Loss on Drying | ≤10.0% |
| Optical (Specific) Rotation | +52.6°~+53.2° |
| Residue on Ignition | ≤0.1% |
| Starch | A yellow color indicates the absence of soluble starch |
| Heavy Metals | 5ppm max |
| Cadmium | 1ppm max |
| Mercury | 1ppm max |
| Granulation(particle size) | 100% pass 20mesh |
| Total Bacteria Count | ≤1,000cfu/g |
| Yeast and Mould | ≤100cfu/g |
| Coliforms | <1/g |
| E. coli | <1/g |
| Salmonella | <1/25g |
