| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| L-Carnitine-L-tartrate, also known as L-carnitine or propionyl L-carnitine, is considered the bioactive form of carnitine in the human body. It is stored in almost all parts of the body, but is primarily found in muscle cells, including heart cells. L-carnitine tartrate is the stable form of L-carnitine; the active ingredient is still L-carnitine, but its content is only 32%, with the other 68% being tartaric acid. Its function and effects are exactly the same as L-carnitine, and it is generally used in the production of capsules and tablets. my country's National Food Additives Hygiene Standard GB2760-1996 stipulates that L-carnitine tartrate is a food fortifier and can be used in chewable tablets, liquids, capsules, milk powder, and milk beverages. | |||||||||
36687-82-8
bosschem
36687-82-8
L-Carnitine-L-tartrate Basic information | |
Product Name: | L-Carnitine-L-tartrate |
CAS: | 36687-82-8 |
MF: | C11H20NO9- |
MW: | 310.28 |
EINECS: | 459-550-9 |
Mol File: | 36687-82-8.mol |
L-Carnitine-L-tartrate Chemical Properties | |
Boiling point | 196.6℃ at 101.3kPa |
density | 1.216 at 20℃ |
vapor pressure | 20-134hPa at 35-50℃ |
storage temp. | Sealed in dry,Room Temperature |
solubility | Methanol (Slightly), Water (Slightly) |
form | Solid |
color | White to Off-White |
InChI | InChI=1/C7H15NO3.C4H6O6/c1-8(2,3)5-6(9)4-7(10)11;5-1(3(7)8)2(6)4(9)10/h6,9H,4-5H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/p-1/t6-;1-,2-/s3 |
InChIKey | KCSRITPMKZWOGA-FYZOBXCZSA-N |
SMILES | [C@H](O)(C(=O)[O-])[C@@H](O)C(=O)[O-].C([C@H](O)CC(=O)O)[N+](C)(C)C |&1:0,5,11,r| |
LogP | -2.9 at 50℃ and pH5.54 |
Surface tension | 55mN/m at 1g/L and 20℃ |
CAS DataBase Reference | 36687-82-8(CAS DataBase Reference) |
content is empty!