 |
| Puri-Xylane, commonly known as Boswellia, is a xylose derivative with anti-aging properties. It can promote the synthesis of collagen, making the skin stronger and more elastic, improving fine lines on the neck, and preventing aging. Boswellia is a sugar protein mixture derived from xylose. Since xylose is abundant in beech trees and has the ability to promote the formation of glucosaminoglycans (GAGs), which are glycoproteins. As Boswellia extracted from beech trees, its effect is similar to that of xylose. | |||||||||
439685-79-7
futurechemical
439685-79-7
Pro-xylane Basic information | |
cosmetic ingredient Physical Form Cosmetics Application function | |
Product Name: | Pro-xylane |
CAS: | 439685-79-7 |
MF: | C8H16O5 |
MW: | 192.21 |
EINECS: | 456-880-5 |
Product Categories: | API;439685-79-7;1 |
Mol File: | 439685-79-7.mol |
Pro-xylane Chemical Properties | |
Boiling point | 376.0±42.0 °C(Predicted) |
density | 1.368±0.06 g/cm3(Predicted) |
vapor pressure | 0Pa at 25℃ |
storage temp. | Store at -20°C |
solubility | Water: 250 mg/mL (1300.66 mM); DMSO: ≥ 83.33 mg/mL (433.54 mM) |
form | Liquid |
pka | 13.55±0.70(Predicted) |
color | Colorless to light yellow |
Cosmetics Ingredients Functions | SKIN CONDITIONING |
InChI | InChI=1/C8H16O5/c1-4(9)2-6-8(12)7(11)5(10)3-13-6/h4-12H,2-3H2,1H3/t4,5-,6+,7+,8+/s3 |
InChIKey | KOGFZZYPPGQZFZ-ZXWVZLFTNA-N |
SMILES | C([C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)C(O)C |&1:1,4,6,8,r| |
LogP | -2.07 |
