| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| L-Selenomethionine is a chiral amino acid and a major natural food form of selenium. It has various physiological activities and is widely used in basic biochemical research. | |||||||||
3211-76-5
bosschem
3211-76-5
L-Selenomethionine Basic information | |
Product Name: | L-Selenomethionine |
CAS: | 3211-76-5 |
MF: | C5H11NO2Se |
MW: | 196.11 |
EINECS: | 608-705-0 |
Mol File: | 3211-76-5.mol |
L-Selenomethionine Chemical Properties | |
Melting point | 265 °C |
alpha | 18 º (c=1, 1N HCl) |
Boiling point | 320.8±37.0 °C(Predicted) |
refractive index | 18 ° (C=0.5, 2mol/L HCl) |
storage temp. | -20°C |
solubility | H2O: 50 mg/mL |
pka | 2.26±0.10(Predicted) |
form | powder |
color | white to off-white |
Water Solubility | soluble |
Merck | 148,441 |
Cosmetics Ingredients Functions | ANTIOXIDANT |
InChI | InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
InChIKey | RJFAYQIBOAGBLC-BYPYZUCNSA-N |
SMILES | C(O)(=O)[C@@H](N)CC[Se]C |
LogP | 0.152 (est) |
CAS DataBase Reference | 3211-76-5(CAS DataBase Reference) |
content is empty!