 |
| L-Carnosine, scientifically known as β-alanyl-L-histidine, is a dipeptide composed of the amino acids β-alanine and L-histidine, and appears as a crystalline solid. It is primarily concentrated in human muscle and brain tissue. Studies have confirmed its strong antioxidant properties, capable of scavenging reactive oxygen species that cause excessive oxidation of cell membrane fatty acids, thus benefiting the human body. | |||||||||
305-84-0
bosschem
305-84-0
L-Carnosine Basic information | |
Product Name: | L-Carnosine |
CAS: | 305-84-0 |
MF: | C9H14N4O3 |
MW: | 226.23 |
EINECS: | 206-169-9 |
Mol File: | 305-84-0.mol |
L-Carnosine Chemical Properties | |
Melting point | 253 °C (dec.) (lit.) |
alpha | 20.9 º (c=1.5, H2O) |
Boiling point | 367.84°C (rough estimate) |
density | 1.2673 (rough estimate) |
vapor pressure | 0Pa at 25℃ |
refractive index | 21 ° (C=2, H2O) |
storage temp. | -20°C |
solubility | DMSO (Very Slightly), Water (Slightly) |
pka | 2.62(at 25℃) |
form | crystalline |
color | White |
Odor | at 100.00%. odorless |
Optical Rotation | 24.12 |
Water Solubility | almost transparency |
Merck | 141,850 |
BRN | 87671 |
Stability: | Stable, but may be heat sensitive - store cold. Incompatible with strong oxidizing agents. |
Major Application | food and beverages |
personal care | |
pharmaceutical | |
Cosmetics Ingredients Functions | SKIN CONDITIONING |
InChI | 1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
SMILES | NCCC(=O)N[C@@H](Cc1c[nH]cn1)C(O)=O |
LogP | -3.8 at 22℃ |
CAS DataBase Reference | 305-84-0(CAS DataBase Reference) |
EPA Substance Registry System | L-Histidine, .beta.-alanyl- (305-84-0) |
