Availability: | |
---|---|
Quantity: | |
19438-64-3
Boss Chemical
19438-64-3
Methyl tetrahydrophthalic anhydride Basic information | |
Product Name: | Methyl tetrahydrophthalic anhydride |
CAS: | 19438-64-3 |
MF: | C9H10O3 |
MW: | 166.17 |
EINECS: | 234-290-7;251-823-9 |
Mol File: | 19438-64-3.mol |
Methyl tetrahydrophthalic anhydride Chemical Properties | |
Boiling point | 308.9±41.0 °C(Predicted) |
density | 1?+-.0.06 g/cm3(Predicted) |
storage temp. | -20°C, sealed storage, away from moisture |
Appearance | Colorless to light yellow Liquid |
InChI | InChI=1S/C9H10O3/c1-5-2-3-6-7(4-5)9(11)12-8(6)10/h4,6-7H,2-3H2,1H3 |
InChIKey | MWSKJDNQKGCKPA-UHFFFAOYSA-N |
SMILES | C1(=O)C2C(CCC(C)=C2)C(=O)O1 |
CAS DataBase Reference | 19438-64-3(CAS DataBase Reference) |
Methyl tetrahydrophthalic anhydride Basic information | |
Product Name: | Methyl tetrahydrophthalic anhydride |
CAS: | 19438-64-3 |
MF: | C9H10O3 |
MW: | 166.17 |
EINECS: | 234-290-7;251-823-9 |
Mol File: | 19438-64-3.mol |
Methyl tetrahydrophthalic anhydride Chemical Properties | |
Boiling point | 308.9±41.0 °C(Predicted) |
density | 1?+-.0.06 g/cm3(Predicted) |
storage temp. | -20°C, sealed storage, away from moisture |
Appearance | Colorless to light yellow Liquid |
InChI | InChI=1S/C9H10O3/c1-5-2-3-6-7(4-5)9(11)12-8(6)10/h4,6-7H,2-3H2,1H3 |
InChIKey | MWSKJDNQKGCKPA-UHFFFAOYSA-N |
SMILES | C1(=O)C2C(CCC(C)=C2)C(=O)O1 |
CAS DataBase Reference | 19438-64-3(CAS DataBase Reference) |
content is empty!