 |
| N. N '- di (2,6-diisopropylphenyl) carbodiimide is an anti hydrolysis agent. Anti hydrolysis agent k-1 is a steric hindrance aromatic carbodiimide based anti hydrolysis stabilizer that reacts with hydrolysis products such as carboxylic acids or water to prevent self catalytic hydrolysis degradation and improve the service life of many polymers, especially under harsh usage conditions such as high temperature, humidity, and acid-base environments. Mainly used for stabilizing polyester products and polyurethane products (such as PU systems, MDI prepolymers, etc.) tpu、 Adhesives, polyamide nylon products, and hydrolysis stabilizers for easily hydrolyzed plastics such as EVA. | |||||||||
2162-74-5
bosschemical
2162-74-5
Bis(2,6-diisopropylphenyl)carbodiimide Basic information | |
Uses | |
Product Name: | Bis(2,6-diisopropylphenyl)carbodiimide |
CAS: | 2162-74-5 |
MF: | C25H34N2 |
MW: | 362.56 |
EINECS: | 218-487-5 |
Mol File: | 2162-74-5.mol |
Bis(2,6-diisopropylphenyl)carbodiimide Chemical Properties | |
Melting point | 51 °C |
Boiling point | 152-162 °C(Press: 0.05 Torr) |
density | 0.95±0.1 g/cm3(Predicted) |
vapor pressure | 0.006Pa at 20℃ |
Fp | 197℃ |
storage temp. | 2-8°C |
form | powder to lump |
color | White to Almost white |
Water Solubility | 50μg/L at 20℃ |
InChI | InChI=1S/C25H34N2/c1-16(2)20-11-9-12-21(17(3)4)24(20)26-15-27-25-22(18(5)6)13-10-14-23(25)19(7)8/h9-14,16-19H,1-8H3 |
InChIKey | XLDBGFGREOMWSL-UHFFFAOYSA-N |
SMILES | N(C1C(=CC=CC=1C(C)C)C(C)C)=C=NC1C(=CC=CC=1C(C)C)C(C)C |
LogP | 6.2 at 30℃ |
CAS DataBase Reference | 2162-74-5 |
EPA Substance Registry System | Benzenamine, N,N'-methanetetraylbis[2,6-bis(1-methylethyl)- (2162-74-5) |
