 |
| Ultraviolet absorbers are formulations designed to prevent the passage of large amounts of ultraviolet light. Ultraviolet absorbers should meet the following criteria: good thermal stability, meaning they do not undergo changes due to heat even during processing, and low thermal volatility; Strong UV absorption capability (especially for wavelengths between 290-400 nm), good chemical stability, and no adverse reactions with the components of the finished product; good miscibility, capable of uniform dispersion in the material without blooming or leaching; good photochemical stability of the absorber itself, no decomposition or discoloration; colorless, non-toxic, and odorless; resistant to washing; cost-effective and readily available. UV absorbers can be classified into the following categories based on their chemical structure: salicylate esters, benzophenones, benzotriazoles, substituted acrylonitriles, triazines, and others. Fabrics containing UV absorbers achieve excellent UV blocking effects. They reduce fading and enhance the lightfastness of polyester disperse dyes. UV absorber UV-326 is one such example. | |||||||||
3896-11-5
Boss Chemical
3896-11-5
| UV Absorber 326 Basic information | |
| Product Name: | UV Absorber 326 |
| CAS: | 729335 |
| MF: | C17H18ClN3O |
| MW: | 315.8 |
| EINECS: | 223-445-4 |
| Product Categories: | Polymer Additives;Polymer Science;Industrial/Fine Chemicals;Polymer Additives;Polymer Science;Stabilizers;3896-11-5;UV |
| Mol File: | 3896-11-5.mol |
| UV Absorber 326 Chemical Properties | |
| Melting point | 144-147 °C(lit.) |
| Boiling point | 460.4±55.0 °C(Predicted) |
| density | 1.26±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 9.31±0.48(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Water Solubility | 4μg/L at 20℃ |
| InChI | InChI=1S/C17H18ClN3O/c1-10-7-12(17(2,3)4)16(22)15(8-10)21-19-13-6-5-11(18)9-14(13)20-21/h5-9,22H,1-4H3 |
| InChIKey | OCWYEMOEOGEQAN-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(C)C=C1N1N=C2C=C(Cl)C=CC2=N1 |
| LogP | 6.580 (est) |
| CAS DataBase Reference | 3896-11-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-tert-Butyl-6-(5-chloro-2H-benzotriazol-2-yl)-p-cresol (3896-11-5) |
