| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| IRGANOX 3052 is a white crystalline powder, an organic chemical raw material with CAS number 61167-58-6, primarily used to prevent the aging of materials such as plastics and rubber. | |||||||||
61167-58-6
bosschem
61167-58-6
Irganox 3052 Basic information | |
Product Name: | Irganox 3052 |
CAS: | 61167-58-6 |
MF: | C26H34O3 |
MW: | 394.55 |
EINECS: | 262-634-6 |
Mol File: | 61167-58-6.mol |
Irganox 3052 Chemical Properties | |
Melting point | 128-133°C |
Boiling point | 491℃ |
density | 1.03 |
Fp | 185℃ |
storage temp. | -20°C Freezer, Under inert atmosphere |
solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
form | Solid |
pka | 11.66±0.48(Predicted) |
color | White to Off-White |
Water Solubility | 123ng/L at 20℃ |
InChI | InChI=1S/C26H34O3/c1-10-22(27)29-24-19(12-17(3)14-21(24)26(7,8)9)15-18-11-16(2)13-20(23(18)28)25(4,5)6/h10-14,28H,1,15H2,2-9H3 |
InChIKey | IORUEKDKNHHQAL-UHFFFAOYSA-N |
SMILES | C(OC1=C(CC2=CC(C)=CC(C(C)(C)C)=C2O)C=C(C)C=C1C(C)(C)C)(=O)C=C |
EPA Substance Registry System | 2-tert-Butyl-6-(3-tert-butyl-2-hydroxy-5-methylbenzyl)-4-methylphenyl acrylate (61167-58-6) |
content is empty!