| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| The UV absorber UV-329, also known as 2-(2'-hydroxy-5'-octylphenyl)benzotriazole, is a highly effective anti-aging additive with outstanding performance. It is soluble in benzene, styrene, dichloromethane, and cyclohexane; slightly soluble in alcohols; and insoluble in water; It effectively absorbs UV light in the 270–380 nm range; it is non-flammable, non-explosive, non-toxic, and safe and harmless to use. | |||||||||
3147-75-9
bosschem
3147-75-9
| UV-329 Basic information | |
| Product Name: | UV-329 |
| CAS: | 3147-75-9 |
| MF: | C20H25N3O |
| MW: | 323.43 |
| EINECS: | 221-573-5 |
| Mol File: | 3147-75-9.mol |
| UV-329 Chemical Properties | |
| Melting point | 106-108 °C(lit.) |
| Boiling point | 471.8±55.0 °C(Predicted) |
| density | 1.10±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.07±0.45(Predicted) |
| color | White to Off-White |
| Water Solubility | 2μg/L at 20℃ |
| Cosmetics Ingredients Functions | LIGHT STABILIZER |
| InChIKey | IYAZLDLPUNDVAG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)(C)CC(C)(C)C)C=C1N1N=C2C=CC=CC2=N1 |
| LogP | 7.290 (est) |
| CAS DataBase Reference | 3147-75-9(CAS DataBase Reference) |
| EPA Substance Registry System | Octrizole (3147-75-9) |


content is empty!