 |
| UV-320 is an efficient light stabilizer widely used in plastics and other organic compounds, including unsaturated polyester, PVC, PVC plasticizers, etc. It is used in polyurethane, polyamide, synthetic fibers, especially in the application of resins with polyester and epoxy | |||||||||
3846-71-7
bosschem
3846-71-7
| UV-320 Basic information | |
| Product Name: | UV-320 |
| CAS: | 3846-71-7 |
| MF: | C20H25N3O |
| MW: | 323.43 |
| EINECS: | 223-346-6 |
| Product Categories: | |
| Mol File: | 3846-71-7.mol |
| UV-320 Chemical Properties | |
| Melting point | 152-154°C |
| Boiling point | 444.0±55.0 °C(Predicted) |
| density | 1.10±0.1 g/cm3(Predicted) |
| Fp | 215°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.41±0.48(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C20H25N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,24H,1-6H3 |
| InChIKey | LHPPDQUVECZQSW-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(C(C)(C)C)C=C1N1N=C2C=CC=CC2=N1 |
| CAS DataBase Reference | 3846-71-7(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 2-(2H-benzotriazol-2-yl)-4,6-bis(1,1-dimethylethyl)- (3846-71-7) |
