| Quantity: | |
|---|---|
133745-75-2
Boss Chemical
133745-75-2
| N-Fluorobenzenesulfonimide Basic information | |
| Product Name: | N-Fluorobenzenesulfonimide |
| CAS: | 133745-75-2 |
| MF: | C12H10FNO4S2 |
| MW: | 315.34 |
| EINECS: | 000-000-0 |
| Mol File: | 133745-75-2.mol |
| N-Fluorobenzenesulfonimide Chemical Properties | |
| Melting point | 114-116 °C |
| Boiling point | 471.4±28.0 °C(Predicted) |
| density | 1.4466 (estimate) |
| Fp | 110℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Very soluble in acetonitrile, dichloromethane or THF and less soluble in toluene. |
| pka | -32.45±0.70(Predicted) |
| form | solid |
| color | white |
| BRN | 5348902 |
| InChI | InChI=1S/C12H10FNO4S2/c13-14(19(15,16)11-7-3-1-4-8-11)20(17,18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RLKHFSNWQCZBDC-UHFFFAOYSA-N |
| SMILES | C1(S(N(F)S(C2=CC=CC=C2)(=O)=O)(=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 133745-75-2(CAS DataBase Reference) |
| N-Fluorobenzenesulfonimide Basic information | |
| Product Name: | N-Fluorobenzenesulfonimide |
| CAS: | 133745-75-2 |
| MF: | C12H10FNO4S2 |
| MW: | 315.34 |
| EINECS: | 000-000-0 |
| Mol File: | 133745-75-2.mol |
| N-Fluorobenzenesulfonimide Chemical Properties | |
| Melting point | 114-116 °C |
| Boiling point | 471.4±28.0 °C(Predicted) |
| density | 1.4466 (estimate) |
| Fp | 110℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Very soluble in acetonitrile, dichloromethane or THF and less soluble in toluene. |
| pka | -32.45±0.70(Predicted) |
| form | solid |
| color | white |
| BRN | 5348902 |
| InChI | InChI=1S/C12H10FNO4S2/c13-14(19(15,16)11-7-3-1-4-8-11)20(17,18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RLKHFSNWQCZBDC-UHFFFAOYSA-N |
| SMILES | C1(S(N(F)S(C2=CC=CC=C2)(=O)=O)(=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 133745-75-2(CAS DataBase Reference) |
