 |
| Pyridoxal phosphate (PLP, the main metabolically active form of vitamin B6) is a multifunctional coenzyme that participates in the metabolism of amino compounds. Enzymes that use PLP as a cofactor are called PLP-dependent enzymes (PLP-DEs), and they play important roles in metabolic processes such as sugar, lipid, and amino acid metabolism. Mainly the biosynthesis of amino acids and biological molecules, such as neurotransmitters serotonin, dopamine, epinephrine, norepinephrine, gamma-aminobutyric acid (GABA), and histamine. | |||||||||
41468-25-1
futurechemical
41468-25-1
Pyridoxal 5'-phosphate monohydrate Basic information | |
Description Source Background | |
Product Name: | Pyridoxal 5'-phosphate monohydrate |
CAS: | 41468-25-1 |
MF: | C8H12NO7P |
MW: | 265.16 |
EINECS: | 609-929-1 |
Mol File: | 41468-25-1.mol |
Pyridoxal 5'-phosphate monohydrate Chemical Properties | |
Melting point | 140-143 °C(lit.) |
storage temp. | 2-8°C |
solubility | Acetonitrile (Slightly), DMSO (Slightly) |
form | Crystalline Powder |
color | Pale yellow |
biological source | synthetic |
Water Solubility | 5 g/L (20 ºC) |
Sensitive | Light Sensitive |
Merck | 147,979 |
BRN | 234749 |
Stability: | Air Sensitive, Moisture Sensitive |
Major Application | cell analysis |
InChI | InChI=1S/C8H10NO6P.H2O/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;/h2-3,11H,4H2,1H3,(H2,12,13,14);1H2 |
InChIKey | CEEQUQSGVRRXQI-UHFFFAOYSA-N |
SMILES | C1(COP(=O)(O)O)=CN=C(C)C(O)=C1C=O.O |
CAS DataBase Reference | 41468-25-1(CAS DataBase Reference) |
