| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Mesitylated benzaldehyde can be used as an intermediate in organic synthesis for dyes, surfactants, and pharmaceuticals, etc. | |||||||||
99-61-6
bosschem
99-61-6
3-Nitrobenzaldehyde Basic information | |
Product Name: | 3-Nitrobenzaldehyde |
CAS: | 99-61-6 |
MF: | C7H5NO3 |
MW: | 151.12 |
EINECS: | 202-772-6 |
Mol File: | 99-61-6.mol |
3-Nitrobenzaldehyde Chemical Properties | |
Melting point | 56 °C |
Boiling point | 285-290 °C |
density | 1.2792 |
vapor density | 5.21 (vs air) |
refractive index | 1.5800 (estimate) |
Fp | 164°C/23mm |
storage temp. | Store below +30°C. |
solubility | 1.6g/l |
form | Granular Powder |
color | Yellow to yellow-brown |
Water Solubility | Slightly soluble in water. |
Sensitive | Air Sensitive |
Merck | 146,587 |
BRN | 386795 |
InChI | 1S/C7H5NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-5H |
InChIKey | ZETIVVHRRQLWFW-UHFFFAOYSA-N |
SMILES | [O-][N+](=O)c1cccc(C=O)c1 |
LogP | 1.47 |
CAS DataBase Reference | 99-61-6(CAS DataBase Reference) |
NIST Chemistry Reference | Benzaldehyde, 3-nitro-(99-61-6) |
EPA Substance Registry System | Benzaldehyde, 3-nitro- (99-61-6) |
EPA Substance Registry System | 3-Buten-1-ol, 3-methyl- (763-32-6) |
content is empty!