| Availability: | |
|---|---|
| Quantity: | |
868-14-4
futurechemical
868-14-4
Potassium Bitartrate Basic information | |
Product Name: | Potassium Bitartrate |
CAS: | 868-14-4 |
MF: | C4H5KO6 |
MW: | 188.18 |
EINECS: | 212-769-1 |
Mol File: | 868-14-4.mol |
Potassium Bitartrate Chemical Properties | |
Melting point | 267°C (dec.) |
alpha | 32.5 º (c=10, 1N NaOH) |
Boiling point | 318℃[at 101 325 Pa] |
bulk density | 720kg/m3 |
density | 1.954 g/mL at 25 °C(lit.) |
vapor pressure | 30.69hPa at 25.2℃ |
refractive index | 1.511 |
Fp | 210℃ |
storage temp. | Inert atmosphere,Room Temperature |
solubility | 5.7g/l |
form | Crystals or Powder |
Specific Gravity | 1.954 |
color | Colorless opaque or white |
Odor | Odorless |
PH | 3.4-3.7 (H2O, 20℃)(saturated solution) |
PH Range | 3.4 - 3.7 at 20 °C |
Optical Rotation | [α]20/D +8.0 to +9.2° |
Water Solubility | Soluble in water and dilute mineral acid. Insoluble in alcohol. |
Merck | 147,615 |
BRN | 6119985 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Cosmetics Ingredients Functions | BUFFERING |
InChI | 1S/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-1/t1-,2-;/m1./s1 |
InChIKey | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
SMILES | [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
LogP | -5.14 |
CAS DataBase Reference | 868-14-4(CAS DataBase Reference) |
EPA Substance Registry System | Potassium bitartrate (868-14-4) |
content is empty!