| Quantity: | |
|---|---|
31566-31-1
bosschemical
31566-31-1
| Glyceryl monostearate Basic information | |
| Product Name: | Glyceryl monostearate |
| CAS: | 31566-31-1 |
| MF: | C21H42O4 |
| MW: | 358.56 |
| EINECS: | 250-705-4 |
| Mol File: | 31566-31-1.mol |
| Glyceryl monostearate Chemical Properties | |
| Melting point | 78-81 °C |
| Boiling point | 410.96°C (rough estimate) |
| density | 0.97 |
| refractive index | 1.4400 (estimate) |
| Fp | >500 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in hot ethanol, ether, chloroform, hot acetone, mineral oil, and fixed oils. Practically insoluble in water, but may be dispersed in water with the aid of a small amount of soap or other surfactant. |
| form | Powder |
| color | Pure-white or cream-colored, wax-like solid |
| Odor | faint odor |
| Water Solubility | Soluble in hot organic solvents.Soluble in hot water. Slightly soluble in ethanol. Insoluble in aliphatic solvents. |
| Merck | 144,489 |
| Exposure limits | ACGIH: TWA 10 mg/m3; TWA 3 mg/m3 |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChIKey | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| SMILES | C(OCC(CO)O)(=O)CCCCCCCCCCCCCCCCC |
| CAS DataBase Reference | 31566-31-1(CAS DataBase Reference) |
| EPA Substance Registry System | Glyceryl monostearate (31566-31-1) |
| Glyceryl monostearate Basic information | |
| Product Name: | Glyceryl monostearate |
| CAS: | 31566-31-1 |
| MF: | C21H42O4 |
| MW: | 358.56 |
| EINECS: | 250-705-4 |
| Mol File: | 31566-31-1.mol |
| Glyceryl monostearate Chemical Properties | |
| Melting point | 78-81 °C |
| Boiling point | 410.96°C (rough estimate) |
| density | 0.97 |
| refractive index | 1.4400 (estimate) |
| Fp | >500 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in hot ethanol, ether, chloroform, hot acetone, mineral oil, and fixed oils. Practically insoluble in water, but may be dispersed in water with the aid of a small amount of soap or other surfactant. |
| form | Powder |
| color | Pure-white or cream-colored, wax-like solid |
| Odor | faint odor |
| Water Solubility | Soluble in hot organic solvents.Soluble in hot water. Slightly soluble in ethanol. Insoluble in aliphatic solvents. |
| Merck | 144,489 |
| Exposure limits | ACGIH: TWA 10 mg/m3; TWA 3 mg/m3 |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChIKey | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| SMILES | C(OCC(CO)O)(=O)CCCCCCCCCCCCCCCCC |
| CAS DataBase Reference | 31566-31-1(CAS DataBase Reference) |
| EPA Substance Registry System | Glyceryl monostearate (31566-31-1) |
