 |
| Glyceryl monostearate is soluble in hot organic solvents such as ethanol, benzene, acetone, mineral oil, fatty oils, etc. It is insoluble in water, but it can be dispersed in hot water as an emulsion under strong stirring. | |||||||||
31566-31-1
bosschemical
31566-31-1
| Glyceryl monostearate Basic information | |
| Product Name: | Glyceryl monostearate |
| CAS: | 31566-31-1 |
| MF: | C21H42O4 |
| MW: | 358.56 |
| EINECS: | 250-705-4 |
| Mol File: | 31566-31-1.mol |
| Glyceryl monostearate Chemical Properties | |
| Melting point | 78-81 °C |
| Boiling point | 410.96°C (rough estimate) |
| density | 0.97 |
| refractive index | 1.4400 (estimate) |
| Fp | >500 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in hot ethanol, ether, chloroform, hot acetone, mineral oil, and fixed oils. Practically insoluble in water, but may be dispersed in water with the aid of a small amount of soap or other surfactant. |
| form | Powder |
| color | Pure-white or cream-colored, wax-like solid |
| Odor | faint odor |
| Water Solubility | Soluble in hot organic solvents.Soluble in hot water. Slightly soluble in ethanol. Insoluble in aliphatic solvents. |
| Merck | 144,489 |
| Exposure limits | ACGIH: TWA 10 mg/m3; TWA 3 mg/m3 |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChIKey | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| SMILES | C(OCC(CO)O)(=O)CCCCCCCCCCCCCCCCC |
| CAS DataBase Reference | 31566-31-1(CAS DataBase Reference) |
| EPA Substance Registry System | Glyceryl monostearate (31566-31-1) |
