| Quantity: | |
|---|---|
9003-27-4
bosschemical
9003-27-4
| Polyisobutylene Basic information | |
| Product Name: | Polyisobutylene |
| CAS: | 9003-27-4 |
| MF: | C4H8 |
| MW: | 56.10632 |
| EINECS: | 618-360-8 |
| Mol File: | 9003-27-4.mol |
| Polyisobutylene Chemical Properties | |
| Melting point | 54-56 °C |
| Boiling point | 300 °C |
| density | 0.92 g/mL at 25 °C (lit.) |
| Tg | -61 |
| Tg | -62 |
| Tg | -64 |
| Tg | -75 |
| refractive index | n20/D 1.51 |
| Fp | >212 |
| Fp | >482 |
| form | slab/chunk |
| color | colorlessor white |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| InChIKey | VQTUBCCKSQIDNK-UHFFFAOYSA-N |
| SMILES | C=C(C)C |
| Surface tension | 33.6mN/m at 20°C |
| EPA Substance Registry System | Polyisobutylene (9003-27-4) |
| Polyisobutylene Basic information | |
| Product Name: | Polyisobutylene |
| CAS: | 9003-27-4 |
| MF: | C4H8 |
| MW: | 56.10632 |
| EINECS: | 618-360-8 |
| Mol File: | 9003-27-4.mol |
| Polyisobutylene Chemical Properties | |
| Melting point | 54-56 °C |
| Boiling point | 300 °C |
| density | 0.92 g/mL at 25 °C (lit.) |
| Tg | -61 |
| Tg | -62 |
| Tg | -64 |
| Tg | -75 |
| refractive index | n20/D 1.51 |
| Fp | >212 |
| Fp | >482 |
| form | slab/chunk |
| color | colorlessor white |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| InChIKey | VQTUBCCKSQIDNK-UHFFFAOYSA-N |
| SMILES | C=C(C)C |
| Surface tension | 33.6mN/m at 20°C |
| EPA Substance Registry System | Polyisobutylene (9003-27-4) |
