| Availability: | |
|---|---|
| Quantity: | |
17557-23-2
Boss Chemical
17557-23-2
| Neopentyl glycol diglycidyl ether Basic information | |
| Product Name: | Neopentyl glycol diglycidyl ether |
| CAS: | 17557-23-2 |
| MF: | C11H20O4 |
| MW: | 216.27 |
| EINECS: | 241-536-7 |
| Product Categories: | Oxiranes;Simple 3-Membered Ring Compounds;Epoxide Monomers;Monomers;Polymer Science |
| Mol File: | 17557-23-2.mol |
| Neopentyl glycol diglycidyl ether Chemical Properties | |
| Boiling point | 103-107 °C/1 mmHg (lit.) |
| density | 1.04 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| refractive index | n20/D 1.457(lit.) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 0.5-1.0 g/100 mL at 20.5 ºC |
| Stability: | Stable. Incompatible with strong oxidizing agents, sulfuric acid, dichromates. Combustible. |
| InChI | InChI=1S/C11H20O4/c1-11(2,7-12-3-9-5-14-9)8-13-4-10-6-15-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | KUAUJXBLDYVELT-UHFFFAOYSA-N |
| SMILES | C(OCC1CO1)C(C)(C)COCC1CO1 |
| LogP | 0.646 (est) |
| CAS DataBase Reference | 17557-23-2(CAS DataBase Reference) |
| EPA Substance Registry System | Neopentyl glycol diglycidyl ether (17557-23-2) |
content is empty!