| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Ultraviolet absorber UV-928 (CAS No. 73936-91-1) is a benzotriazole-based ultraviolet absorber with the chemical name 2-(2H-benzotriazole-2-yl)-6-(1-methyl-1-phenethyl)-4-(1,1,3, 3-tetramethylbutylphenol). Its molecular formula is C₂₉H₃₅N₃O, with a molecular weight of 441.60. It appears as white to light yellow granular crystalline powder and has a density of 1.07. This substance has a melting point range of 108-110°C and possesses a broad ultraviolet absorption characteristic, capable of absorbing ultraviolet rays in the 270-380nm band, with absorption peaks located at 303nm and 343nm. | |||||||||
73936-91-1
bosschemical
73936-91-1
| UV absorber-928 Basic information | |
| Description Uses | |
| Product Name: | UV absorber-928 |
| CAS: | 73936-91-1 |
| MF: | C29H35N3O |
| MW: | 441.61 |
| EINECS: | 422-600-5 |
| Mol File: | 73936-91-1.mol |
| UV absorber-928 Chemical Properties | |
| Melting point | 112 °C |
| Boiling point | 555.5±60.0 °C(Predicted) |
| density | 1.07 |
| solubility | soluble in Toluene |
| pka | 8.05±0.50(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C29H35N3O/c1-27(2,3)19-28(4,5)21-17-22(29(6,7)20-13-9-8-10-14-20)26(33)25(18-21)32-30-23-15-11-12-16-24(23)31-32/h8-18,33H,19H2,1-7H3 |
| InChIKey | UZUNCLSDTUBVCN-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C2=CC=CC=C2)C)C=C(C(C)(C)CC(C)(C)C)C=C1N1N=C2C=CC=CC2=N1 |
| EPA Substance Registry System | Phenol, 2-(2H-benzotriazol-2-yl)-6-(1-methyl-1-phenylethyl)-4-(1,1,3,3-tetramethylbutyl)- (73936-91-1) |


content is empty!