| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Highly efficient scale inhibitor and corrosion inhibitor blends are the most widely used and one of the best performing products, as well as an excellent stabilizer for zinc salts. | |||||||||
40372-66-5
Boss Chemical
40372-66-5
| 2-Phosphonobutane-1,2,4-tricarboxylic acid sodium salt Basic information | |
| Product Name: | 2-Phosphonobutane-1,2,4-tricarboxylic acid sodium salt |
| CAS: | 40372-66-5 |
| MF: | C7H12NaO9P |
| MW: | 294.13 |
| EINECS: | 254-894-4 |
| Mol File: | 40372-66-5.mol |
| 2-Phosphonobutane-1,2,4-tricarboxylic acid sodium salt Chemical Properties | |
| InChI | InChI=1S/C7H11O9P.Na.H/c8-4(9)1-2-7(6(12)13,3-5(10)11)17(14,15)16;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13)(H2,14,15,16);; |
| InChIKey | KWCVHKMCETZUIS-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)(P(O)(O)=O)(CC(=O)O)CCC(=O)O.[NaH] |
| EPA Substance Registry System | 1,2,4-Butanetricarboxylic acid, 2-phosphono-, sodium salt (40372-66-5) |


content is empty!