| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Photoinitiator 379 belongs to the α -amino ketone derivatives. It features good thermal stability, a long storage period, excellent solubility, light color, good anti-yellowing performance, fast photocuring speed, and good deep curing performance. | |||||||||
119344-86-4
bosschemical
119344-86-4
| PI379 Basic information | |
| Product Name: | PI379 |
| CAS: | 119344-86-4 |
| MF: | C24H32N2O2 |
| MW: | 380.52 |
| EINECS: | 438-340-0 |
| PI379 Chemical Properties | |
| Boiling point | 542.0±50.0 °C(Predicted) |
| density | 1.083 |
| vapor pressure | 0Pa at 25℃ |
| solubility | 2.75 in mg/100g standard fat at 20 ℃ |
| pka | 6.74±0.50(Predicted) |
| Water Solubility | 1.9mg/L at 20℃ |
| InChI | InChI=1S/C24H32N2O2/c1-5-24(25(3)4,18-20-8-6-19(2)7-9-20)23(27)21-10-12-22(13-11-21)26-14-16-28-17-15-26/h6-13H,5,14-18H2,1-4H3 |
| InChIKey | PUBNJSZGANKUGX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N2CCOCC2)C=C1)(=O)C(N(C)C)(CC1=CC=C(C)C=C1)CC |
| LogP | 4.1 at 25℃ |
| CAS DataBase Reference | 119344-86-4 |
| EPA Substance Registry System | 1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpholinyl)phenyl]- (119344-86-4) |


content is empty!