| Quantity: | |
|---|---|
41484-35-9
Boss Chemical
41484-35-9
| Antioxidant 1035 Basic information | |
| Product Name: | Antioxidant 1035 |
| CAS: | 41484-35-9 |
| MF: | C38H58O6S |
| MW: | 642.94 |
 EINECS: | 255-392-8 |
| Mol File: | 41484-35-9.mol |
| Antioxidant 1035 Chemical Properties | |
| Melting point | 78 °C |
| Boiling point | 659.4±55.0 °C(Predicted) |
| density | 1.072±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.02±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChIKey | VFBJXXJYHWLXRM-UHFFFAOYSA-N |
| SMILES | C(C1C=C(C(C)(C)C)C(O)=C(C(C)(C)C)C=1)CC(=O)OCCSCCOC(=O)CCC1C=C(C(C)(C)C)C(O)=C(C(C)(C)C)C=1 |
| CAS DataBase Reference | 41484-35-9(CAS DataBase Reference) |
| EPA Substance Registry System | Thiodi-2,1-ethanediyl bis[3,5-di-tert-butyl-4-hydroxyhydrocinnamate] (41484-35-9) |
| Antioxidant 1035 Basic information | |
| Product Name: | Antioxidant 1035 |
| CAS: | 41484-35-9 |
| MF: | C38H58O6S |
| MW: | 642.94 |
| EINECS: | 255-392-8 |
| Mol File: | 41484-35-9.mol |
| Antioxidant 1035 Chemical Properties | |
| Melting point | 78 °C |
| Boiling point | 659.4±55.0 °C(Predicted) |
| density | 1.072±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.02±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChIKey | VFBJXXJYHWLXRM-UHFFFAOYSA-N |
| SMILES | C(C1C=C(C(C)(C)C)C(O)=C(C(C)(C)C)C=1)CC(=O)OCCSCCOC(=O)CCC1C=C(C(C)(C)C)C(O)=C(C(C)(C)C)C=1 |
| CAS DataBase Reference | 41484-35-9(CAS DataBase Reference) |
| EPA Substance Registry System | Thiodi-2,1-ethanediyl bis[3,5-di-tert-butyl-4-hydroxyhydrocinnamate] (41484-35-9) |
