 |
| Zinc methacrylate is a kind of additives with unique role in rubber industry, because the structure contains double bonds and ionic bonds, so that it has good compatibility with polar rubber, and at the same time has the performance of acid, alkali, oil, corrosion and high temperature resistance, and the combination with the rubber body can obtain salt crosslinking bonds, improve the strength of the vulcanized rubber, and improve the performance of high and low temperatures. | |||||||||
13189-00-9
bosschemical
13189-00-9
| Zinc methacrylate Basic information | |
| Product Name: | Zinc methacrylate |
| CAS: | 13189-00-9 |
| MF: | C8H10O4Zn |
| MW: | 235.55 |
| EINECS: | 236-144-8 |
| Mol File: | 13189-00-9.mol |
| Zinc methacrylate Chemical Properties | |
| Melting point | 229-232 °C(lit.) |
| density | 1,4 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Specific Gravity | 1.48 |
| Water Solubility | 100mg/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C4H6O2.Zn/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
| SMILES | C(=O)(O[Zn]OC(=O)C(=C)C)C(=C)C |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 13189-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc dimethacrylate (13189-00-9) |
