| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Ursolic acid, also known as ursolic acid or ursolic acid, is a pentacyclic triterpenoid compound extracted from the evergreen creeping shrub bear fruit of the Rhododendron family. It has a special odor and produces large and shiny crystals in anhydrous ethanol, while fine needle like crystals in dilute ethanol. | |||||||||
77-52-1
bosschem
77-52-1
| Ursolic acid Basic information | |
| Overview Origins Properties and biological effects References | |
| Product Name: | Ursolic acid |
| CAS: | 77-52-1 |
| MF: | C30H48O3 |
| MW: | 456.7 |
| EINECS: | 201-034-0 |
| Mol File: | 77-52-1.mol |
| Ursolic acid Chemical Properties | |
| Melting point | 292 °C (dec.) (lit.) |
| alpha | 59 º (c=0.3, pyridine) |
| Boiling point | 502.79°C (rough estimate) |
| density | 1.0261 (rough estimate) |
| refractive index | 1.4940 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO (up to 25 mg/ml with warming) |
| pka | 4.68±0.70(Predicted) |
| form | Crystalline Powder or Needles |
| color | White to off-white |
| Optical Rotation | +6620 (c 1.4, C5H5N) |
| Water Solubility | insoluble |
| Merck | 149,890 |
| BRN | 2228563 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 2 months. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | FRAGRANCE |
| PERFUMING | |
| SKIN CONDITIONING | |
| InChIKey | WCGUUGGRBIKTOS-GPOJBZKASA-N |
| SMILES | [H][C@@]12CC[C@]3(C)[C@]([H])(CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@]5(CC[C@@]34C)C(O)=O)[C@@]1(C)CC[C@H](O)C2(C)C |
| LogP | 8.731 (est) |
| CAS DataBase Reference | 77-52-1(CAS DataBase Reference) |
| EPA Substance Registry System | Urs-12-en-28-oic acid, 3-hydroxy-, (3.beta.)- (77-52-1) |


content is empty!