| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Colorless to white crystalline or white crystalline powder, with a slightly unique taste. Easy to dissolve in water (41g/100m1), slightly soluble in methanol, insoluble in ethanol | |||||||||
3387-36-8
bosschem
3387-36-8
| Uridine 5′-monophosphate disodium salt Basic information | |
| Product Name: | Uridine 5′-monophosphate disodium salt |
| CAS: | 3387-36-8 |
| MF: | C9H14N2NaO9P |
| MW: | 348.18 |
| EINECS: | 222-211-9 |
| Mol File: | 3387-36-8.mol |
| Uridine 5′-monophosphate disodium salt Chemical Properties | |
| Melting point | 208-210 °C |
| refractive index | -14 ° (C=1, H2O) |
| storage temp. | 2-8°C |
| solubility | Water (Slightly) |
| pka | 6.4, 9.5(at 25℃) |
| form | Crystalline Powder |
| color | White |
| biological source | (chemical) |
| Water Solubility | 40 g/100 mL (20 ºC) |
| BRN | 3582885 |
| Stability: | Very Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1/C9H13N2O9P.Na.H/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;;/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18);;/t4-,6-,7-,8-;;/s3 |
| InChIKey | KURVIXMFFSNONZ-WFIJOQBCSA-L |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,11,r| |
| CAS DataBase Reference | 3387-36-8(CAS DataBase Reference) |


content is empty!