| Quantity: | |
|---|---|
546-68-9
bosschem
546-68-9
| Titanium tetraisopropanolate Basic information | |
| Reactions | |
| Product Name: | Titanium tetraisopropanolate |
| CAS: | 546-68-9 |
| MF: | C12H28O4Ti |
| MW: | 284.22 |
| EINECS: | 208-909-6 |
| Mol File: | 546-68-9.mol |
| Titanium tetraisopropanolate Chemical Properties | |
| Melting point | 14-17 °C(lit.) |
| Boiling point | 232 °C(lit.) |
| density | 0.96 g/mL at 20 °C(lit.) |
| vapor pressure | 60.2hPa at 25℃ |
| refractive index | n20/D 1.464(lit.) |
| Fp | 72 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Colorless to pale yellow |
| Specific Gravity | 0.955 |
| Water Solubility | HYDROLYSIS |
| FreezingPoint | 14.8℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| Merck | 149,480 |
| BRN | 3679474 |
| Stability: | Stable, but decomposes in the presence of moisture. Incompatible with aqueous solutions, strong acids, strong oxidizing agents. Flammable. |
| InChI | 1S/4C3H7O.Ti/c4*1-3(2)4;/h4*3H,1-2H3;/q4*-1;+4 |
| InChIKey | VXUYXOFXAQZZMF-UHFFFAOYSA-N |
| SMILES | CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C |
| LogP | 0.05 |
| CAS DataBase Reference | 546-68-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, titanium(4+) salt (546-68-9) |
| Item | Specification | Results | Judge |
|---|---|---|---|
| Lot No. | - | TIPT-20240324 | TIPT-20240324 |
| Packing(190kg/drum) | - | 190 | 190 |
| Appearance | Colorless or yellowish, transparent liquid | Colorless liquid | OK |
| Color at time of mfg(APHA) | ≤100 | 20 | OK |
| TiO₂ Content(%) | 27.5‑28.2 | 28.04 | OK |
| Ti Content(%) | 16.5‑16.9 | 16.80 | OK |
| Specific Gravity(25℃) | 0.955±0.005 | 0.954 | OK |
| Chloride Content(PPM) | 50(max) | 15.0 | OK |
| Final Judge | - | - | OK |
| Inspector | - | Wang Jing | - |
| Confirmation | - | Fu Jinliang | - |
