| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| At room temperature, it is colorless, light yellow to amber transparent viscous oily liquid. Solubility: soluble in organic solvents such as toluene, acetone, ethanol, etc., insoluble in water Stability: Good heat resistance, easily hydrolyzed when in contact with water; Low toxicity, no obvious irritating odor, no discoloration during processing and use Belonging to hypophosphite ester auxiliary antioxidants, it is an efficient non polluting thermal oxygen stabilizer with core functions | |||||||||
26523-78-4
bosschem
26523-78-4
| Tris(nonylphenyl) phosphite Basic information |
| Product Name: | Tris(nonylphenyl) phosphite |
| Synonyms: | TRIS(NONYLPHENYL) PHOSPHITE;TRIS(NONYLPHENYL) PHOSPHITE ESTER;nonyl-phenophosphite(3:1);Phenol,nonyl-,phosphite(3:1);IRGAFOS TNPP;tris(2-nonylphenyl) phosphite;Tri(nonylatedphenyl)phosphite;Tris(nonylphenyl)phosphit |
| CAS: | 26523-78-4 |
| MF: | C45H69O3P |
| MW: | 689 |
| EINECS: | 247-759-6 |
| Product Categories: | Polymer Additives;Polymer Science;Stabilizers |
| Mol File: | 26523-78-4.mol |
| Tris(nonylphenyl) phosphite Chemical Properties |
| Boiling point | >360 °C(lit.) |
| density | 0.99 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.528(lit.) |
| Fp | >230 °F |
| solubility | Benzene (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Thick Oil |
| Specific Gravity | 0.979~0.9870.990 |
| color | Colourless |
| Odor | mild odor |
| Sensitive | Moisture Sensitive |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChIKey | WGKLOLBTFWFKOD-UHFFFAOYSA-N |
| SMILES | P(OC1=CC=CC=C1CCCCCCCCC)(OC1C=CC=CC=1CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC |
| CAS DataBase Reference | 26523-78-4(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, nonyl-, phosphite (3:1) (26523-78-4) |


content is empty!