 |
| White particles or powdery crystals, odorless. The taste is slightly bitter. Slightly soluble in cold water, ethanol, methanol, ether, and acetone, easily soluble in boiling water, glycerol, hydrochloric acid, potassium hydroxide, and sodium hydroxide solutions, insoluble in chloroform, ether, benzene, and petroleum ether. | |||||||||
3115-68-2
bosschem
3115-68-2
| Tetrabutylphosphonium bromide Basic information | |
| Product Name: | Tetrabutylphosphonium bromide |
| CAS: | 3115-68-2 |
| MF: | C16H36BrP |
| MW: | 339.33 |
| EINECS: | 221-487-8 |
| Mol File: | 3115-68-2.mol |
| Tetrabutylphosphonium bromide Chemical Properties | |
| Melting point | 100-103 °C(lit.) |
| density | 1.8[at 20℃] |
| vapor pressure | 0.018Pa at 25℃ |
| Fp | 290 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | crystal |
| color | white |
| Water Solubility | ca 70 g/100 mL |
| Sensitive | Hygroscopic, Light Sensitive |
| BRN | 4160474 |
| Stability: | hygroscopic |
| SMILES | [Br-].CCCC[P+](CCCC)(CCCC)CCCC |
| LogP | -0.44 at 23℃ |
| CAS DataBase Reference | 3115-68-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phosphonium bromide, tetrabutyl(3115-68-2) |
