| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| 1H-Benzotriazole sodium is the sodium salt form of benzotriazole. It is non-toxic, non-corrosive, and non-explosive. It is soluble in water, chloroform, benzene, toluene, and other organic solvents, and is miscible with lower alcohols and ethylene glycol in any proportion. | |||||||||
15217-42-2
Boss Chemical
15217-42-2
| Sodium benzotriazole Basic information | |
| Product Name: | Sodium benzotriazole |
| CAS: | 15217-42-2 |
| MF: | C6H5N3.Na |
| MW: | 142.11 |
| EINECS: | 239-269-6 |
| Mol File: | 15217-42-2.mol |
| Sodium benzotriazole Chemical Properties | |
| density | 1.42[at 20℃] |
| vapor pressure | 0.001Pa at 25℃ |
| pka | 8.37[at 20 ℃] |
| Odor | No odor |
| Water Solubility | 1000g/L at 20℃ |
| InChI | InChI=1S/C6H5N3.Na.H/c1-2-4-6-5(3-1)7-9-8-6;;/h1-4H,(H,7,8,9);; |
| InChIKey | JGEWKYKSDHHXSK-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC=1NN=N2.[NaH] |
| LogP | 0.48 at 22.5℃ |
| EPA Substance Registry System | 1H-Benzotriazole, sodium salt (15217-42-2) |


content is empty!