| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| The dihydrate is a racemic mixture, a colorless monoclinic crystal with a relative density of 1.984. It is highly soluble in water and loses its crystalline water at 100°C to form an anhydrous compound. The hemihydrate has a relative density of 1.98 and a refractive index of 1.526 (β). It loses its crystalline water at 155°C and decomposes at 200–220°C. It is extremely soluble in water and slightly soluble in ethanol. | |||||||||
921-53-9
Boss Chemical
921-53-9
| Potassium tartrate Basic information | |
| Product Name: | Potassium tartrate |
| CAS: | 921-53-9 |
| MF: | C4H4K2O6 |
| MW: | 226.27 |
| EINECS: | 213-067-8 |
| Mol File: | 921-53-9.mol |
| Potassium tartrate Chemical Properties | |
| density | 1.954 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| Fp | 200-220°C |
| Decomposition | 200-220 ºC |
| Stability: | Stable. |
| InChI | InChI=1S/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | AVTYONGGKAJVTE-UHFFFAOYSA-L |
| SMILES | [K+].[K+].C([O-])(=O)C(C(C([O-])=O)O)O |
| LogP | -1.426 (est) |
| CAS DataBase Reference | 921-53-9(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, dipotassium salt (921-53-9) |


content is empty!