| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| White to light brown solid, potassium acrylate is an organic cationic polymer that is non-toxic, non-corrosive, does not generate dust, is easily soluble in water, and is used for coating and viscosity enhancement in drilling. It is suitable for various mud systems and has good anti-collapse properties. | |||||||||
10192-85-5
Boss Chemical
10192-85-5
POTASSIUM ACRYLATE Basic information | |
| Product Name: | POTASSIUM ACRYLATE |
| CAS: | 10192-85-5 |
| MF: | C3H3KO2 |
| MW: | 110.15 |
| EINECS: | 233-473-9 |
| Mol File: | 10192-85-5.mol |
| POTASSIUM ACRYLATE Chemical Properties | |
| Melting point | 194°C |
| Fp | 11°C (52°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 3695913 |
| InChI | InChI=1S/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | ZUBIJGNKOJGGCI-UHFFFAOYSA-M |
| SMILES | C([O-])(=O)C=C.[K+] |
| CAS DataBase Reference | 10192-85-5(CAS DataBase Reference) |
| EPA Substance Registry System | Potassium acrylate (10192-85-5) |


content is empty!