 |
| Can be used as a wet cleaner for steam reactors and steam reactor components, as well as for cleaning unwanted deposits accumulated in gas phase reactors, etching dielectric or metallic materials in gas phase reactors, and doping various materials in gas phase reactors. | |||||||||
756-13-8
bosschemical
756-13-8
 Perfluoro(2-methyl-3-pentanone) Basic information | |
| Product Name: | Perfluoro(2-methyl-3-pentanone) |
| CAS: | 756-13-8 |
| MF: | C6F12O |
| MW: | 316.04 |
| EINECS: | 436-710-6 |
| Mol File: | 756-13-8.mol |
| Perfluoro(2-methyl-3-pentanone) Chemical Properties | |
| Melting point | -108°C |
| Boiling point | 49°C |
| density | 1,6 g/cm3 |
| vapor pressure | 31.6-40.4kPa at 20-25℃ |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.6 |
| Water Solubility | 24-332.6mg/L at 25℃ |
| InChI | InChI=1S/C6F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18 |
| InChIKey | RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(F)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
| LogP | 2.79-5.48 at 20-25℃ |
| EPA Substance Registry System | 3-Pentanone, 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)- (756-13-8) |
