| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Non-flammable liquid with excellent dielectric properties, a wide boiling point range, outstanding material compatibility and thermal stability, low global warming potential (GWP) and zero ozone depletion potential (ODP), and excellent environmental performance characteristics. | |||||||||
163702-08-7
Boss Chemical
163702-08-7
| Methyl perfluoroisobutyl ether Basic information | |
| Product Name: | Methyl perfluoroisobutyl ether |
| CAS: | 163702-08-7 |
| MF: | C5H3F9O |
| MW: | 250.06 |
| EINECS: | 000-000-0 |
| Mol File: | 163702-08-7.mol |
| Methyl perfluoroisobutyl ether Chemical Properties | |
| Boiling point | 20.0±40.0℃ (760 Torr) |
| density | 1.500±0.06 g/cm3 (20 ºC 760 Torr) |
| Fp | -29.6±23.2℃ |
| InChI | InChI=1S/C5H3F9O/c6-2(7)15-1-3(8,4(9,10)11)5(12,13)14/h2H,1H2 |
| InChIKey | JZYGTCBELUZFGX-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(COC(F)F)(F)C(F)(F)F |
| LogP | 3.216 (est) |
| CAS DataBase Reference | 163702-08-7 |
| EPA Substance Registry System | Propane, 2-(difluoromethoxymethyl)-1,1,1,2,3,3,3-heptafluoro- (163702-08-7) |


content is empty!