| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Isolongifolene is a colorless liquid with a boiling range of 123-142ºC/15mmHg, a specific gravity of 0.9230-0.9350, a refractive index of 1.4995-1.5001, an optical rotation of -17.42º, and a purity of 86-80%. It is a raw material for synthesizing fragrances such as ω-AML, ω-HML, isolongifolene, and isolongifolene. | |||||||||
1135-66-6
bosschem
1135-66-6
Isolongifolene Basic information | |
Product Name: | Isolongifolene |
CAS: | 1135-66-6 |
MF: | C15H24 |
MW: | 204.35 |
EINECS: | 214-494-2 |
Mol File: | 1135-66-6.mol |
Isolongifolene Chemical Properties | |
Boiling point | 255-256 °C |
density | 0.930 g/mL at 20 °C(lit.) |
vapor pressure | 5.49Pa at 25℃ |
refractive index | n20/D 1.499 |
Fp | 49°C |
storage temp. | 2-8°C |
solubility | DMSO: 10 mg/mL (48.94 mM) |
form | Liquid |
color | Colorless to light yellow |
Odor | at 100.00 %. woody dusty amber incense |
Odor Type | woody |
Optical Rotation | [α]20/D 138±2°, c = 1% in ethanol |
Water Solubility | 59.998μg/L at 25℃ |
BRN | 2207559 |
Cosmetics Ingredients Functions | PERFUMING |
InChI | 1S/C15H24/c1-13(2)8-5-6-12-14(3,4)11-7-9-15(12,13)10-11/h6,11H,5,7-10H2,1-4H3/t11-,15-/m0/s1 |
InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
SMILES | CC1(C)CCC=C2C(C)(C)[C@H]3CC[C@@]12C3 |
LogP | 5.77 at 25℃ |
CAS DataBase Reference | 1135-66-6(CAS DataBase Reference) |
NIST Chemistry Reference | 2H-2,4a-methanonaphthalene, 1,3,4,5,6,7-hexahydro-1,1,5,5-tetramethyl-, (2s)-(1135-66-6) |
EPA Substance Registry System | 2H-2,4a-Methanonaphthalene, 1,3,4,5,6,7-hexahydro-1,1,5,5-tetramethyl-, (2S,4aR)- (1135-66-6) |
content is empty!