 |
| Diphenylphosphine oxide is an important organic synthesis intermediate, widely used in the synthesis of various pesticides and chiral phosphine ligands. It can also replace alkali metal cyanides as coupling agents in the synthesis of heterocyclic compounds, such as the herbicide paraquat under mild conditions. | |||||||||
4559-70-0
bosschem
4559-70-0
Diphenylphosphine oxide Basic information | |
Product Name: | Diphenylphosphine oxide |
CAS: | 4559-70-0 |
MF: | C12H11OP |
MW: | 202.19 |
EINECS: | 625-671-2 |
Mol File: | 4559-70-0.mol |
Diphenylphosphine oxide Chemical Properties | |
Melting point | 56-57 °C(lit.) |
Boiling point | 102-105°C 0,2mm |
refractive index | 1.608-1.61 |
storage temp. | Inert atmosphere,Room Temperature |
form | Crystals |
color | Yellow to light orange |
Water Solubility | Slightly soluble in water. |
Sensitive | Moisture Sensitive |
InChI | InChI=1S/C12H11OP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
InChIKey | ASUOLLHGALPRFK-UHFFFAOYSA-N |
SMILES | P(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
CAS DataBase Reference | 4559-70-0(CAS DataBase Reference) |
