| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Diethyltoluenediamine can be used in polyurethane to improve the strength and hydrolysis resistance of the products, make the productivity of the products much higher, and make the industrialization of large-size and complex structure polyurethane products possible. | |||||||||
68479-98-1
bosschemical
68479-98-1
| Diethyltoluenediamine Basic information | |
| Uses | |
| Product Name: | Diethyltoluenediamine |
| CAS: | 68479-98-1 |
| MF: | C11H18N2 |
| MW: | 178.28 |
| EINECS: | 270-877-4 |
| Mol File: | 68479-98-1.mol |
| Diethyltoluenediamine Chemical Properties | |
| Boiling point | 310°C |
| density | 1.022 |
| vapor pressure | 0.001Pa at 25℃ |
| Fp | >140°C |
| pka | 4.6[at 20 ℃] |
| Water Solubility | 23g/L at 30℃ |
| InChI | InChI=1S/C11H18N2/c1-4-8-6-10(12)9(5-2)11(13)7(8)3/h6H,4-5,12-13H2,1-3H3 |
| InChIKey | GCIGOEOZGOYSKS-UHFFFAOYSA-N |
| SMILES | C1(C)=C(CC)C=C(N)C(CC)=C1N |
| LogP | 1.38 at 25℃ |
| CAS DataBase Reference | 68479-98-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenediamine, ar,ar-diethyl-ar-methyl- (68479-98-1) |


content is empty!