| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Decyl glucoside is a type of new non-ionic surfactant alkyl glucoside (APG), a colourless transparent liquid. | |||||||||
68515-73-1
Boss Chemical
68515-73-1
| Decyl glucoside Basic information | |
| Product Name: | Decyl glucoside |
| CAS: | 68515-73-1 |
| MF: | C16H32O6 |
| MW: | 320.22 |
| EINECS: | 500-220-1 |
| Product Categories: | |
| Mol File: | 68515-73-1.mol |
| Decyl glucoside Chemical Properties | |
| density | 1.15 g/mL at 20 °C |
| form | liquid |
| color | Clear to light-yellow, viscous liquid |
| Odor | Soapy/detergent-like odor |
| Water Solubility | water: freely soluble at20°C (visual) |
| InChI | InChI=1/C16H32O6/c1-2-3-4-5-6-7-8-9-10-21-16-15(20)14(19)13(18)12(11-17)22-16/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16?/s3 |
| InChIKey | JDRSMPFHFNXQRB-TVHDANIINA-N |
| SMILES | O(CCCCCCCCCC)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:13,16,18,20,r| |
| EPA Substance Registry System | Oligomeric D-glucopyranose decyl octyl glycosides (68515-73-1) |


content is empty!