| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| DCMX, 2,4-dichloro-3,5-dimethylphenol, also known as dichloroxylenol or dichlorom-xylenol, has the CAS registry number 133-53-9, EINECS number 205-109-9, MDL number MFCD00019981, chemical formula C8H8Cl2O, and molecular weight 191.05. This substance belongs to the halogenated phenolic derivatives. It appears as a grayish-white to light yellow powder, with a density of 1.3±0.1 g/cm³, melting point of 92-95℃, and flash point of 114.5±19.9°C. Its solubility in water (20℃) is 0.2 g/L. It is readily soluble in organic solvents such as alcohols, ethers, and ketones (insoluble in acidic solutions). | |||||||||
133-53-9
bosschem
133-53-9
2,4-Dichloro-3,5-dimethylphenol Basic information | |
Product Name: | 2,4-Dichloro-3,5-dimethylphenol |
CAS: | 133-53-9 |
MF: | C8H8Cl2O |
MW: | 191.05 |
EINECS: | 205-109-9 |
Mol File: | 133-53-9.mol |
2,4-Dichloro-3,5-dimethylphenol Chemical Properties | |
Melting point | 91-96 °C |
Boiling point | 273.74°C (rough estimate) |
density | 1.2559 (rough estimate) |
refractive index | 1.5605 (estimate) |
Fp | 138°C |
form | powder to crystal |
pka | 8.30±0.28(Predicted) |
color | White to Light yellow to Light red |
Merck | 143,076 |
BRN | 2209273 |
Cosmetics Ingredients Functions | DEODORANT |
ANTIMICROBIAL | |
InChI | InChI=1S/C8H8Cl2O/c1-4-3-6(11)8(10)5(2)7(4)9/h3,11H,1-2H3 |
InChIKey | IYOLBFFHPZOQGW-UHFFFAOYSA-N |
SMILES | C1(O)=CC(C)=C(Cl)C(C)=C1Cl |
CAS DataBase Reference | 133-53-9(CAS DataBase Reference) |
EPA Substance Registry System | 2,4-Dichloro-3,5-dimethylphenol (133-53-9) |
content is empty!