| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Cycloastragenol is a triterpenoid saponin compound, mainly obtained by the hydrolysis of astragaloside IV. | |||||||||
84605-18-5
bosschem
84605-18-5
cycloastragenol Basic information | |
Product Name: | cycloastragenol |
CAS: | 84605-18-5 |
MF: | C30H50O5 |
MW: | 490.71 |
EINECS: | 000-000-0 |
Mol File: | 84605-18-5.mol |
cycloastragenol Chemical Properties | |
Melting point | >220°C (dec.) |
Boiling point | 617.2±55.0 °C(Predicted) |
density | 1.2 |
storage temp. | Refrigerator |
solubility | Chloroform (Slightly), Methanol (Slightly), Pyridine (Slightly) |
pka | 14.57±0.29(Predicted) |
form | Solid |
color | White |
InChIKey | WENNXORDXYGDTP-LMDVAILRNA-N |
SMILES | C1C[C@]23C[C@@]42CC[C@]2(C)[C@@H]([C@]5(C)CC[C@H](C(C)(C)O)O5)[C@@H](O)C[C@@]2(C)[C@@H]4C[C@H](O)[C@H]3C(C)(C)[C@H]1O |&1:2,4,7,9,10,14,20,23,25,27,29,33,r| |
Item | Specification | Result | Method |
Maker Compounds | Cycloastragenol≥98.00% | 98.46% | HPLC-RID |
Organoleptic | |||
Appearance | White powder | Conforms | Visual |
Odor | Characteristic | Conforms | Organoleptic |
Taste | Characteristic | Conforms | Organoleptic |
Physical Characteristics | |||
Particle Size | 100%Through 80 mesh | Conforms | GB5507-85 |
Loss on Drying | ≤2.00% | 0.85% | CP2015 |
Ash content | ≤0.50% | 0.1% | CP2015 |
Residual Solvent | <0.1% | Confirms | GC-MS |
Pesticide Residue | Negative | Confirms | GB/T5009-19-199 |
Heavy metals | |||
Total Heavy Metals | ≤5ppm | Conforms | Atomic Absorption |
As | ≤0.5ppm | 0.0062ppm | Atomic Absorption |
Pb | ≤0.5ppm | 0.0085ppm | Atomic Absorption |
Hg | ≤0.5 ppm | 0.002ppm | Atomic Absorption |
Cd | ≤0.5ppm | 0.002ppm | Atomic Absorption |
Microbiological Tests | |||
Total bacteria count | ≤1000cfu/g | Conforms | AOAC |
Yeast & Moulds | ≤100cfu/g | Conforms | AOAC |
E.Coli | Negative | Negative | AOAC |
Salmonella | Negative | Negative | AOAC |
Pseudomonas aeruginosa | Negative | Negative | AOAC |
Enterobacteriaceae | Negative | Negative | AOAC |
Staphylococcus aureus | Negative | Negative | AOAC |
content is empty!