| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Organic chlorine disinfectant is mainly used for disinfecting drinking water utensils, various utensils, fruits and vegetables (5ppm), and disinfecting aquaculture water and enamel utensils (1%). It can also be used for cleaning milk and milking cups, as well as flushing and disinfecting the urinary tract and purulent wounds of livestock | |||||||||
127-52-6
futurechemical
127-52-6
Chloramine B Basic information | |
Product Name: | Chloramine B |
CAS: | 127-52-6 |
MF: | C6H5ClNNaO2S |
MW: | 213.62 |
EINECS: | 204-847-9 |
Mol File: | 127-52-6.mol |
Chloramine B Chemical Properties | |
Melting point | 190°C |
Boiling point | 189℃[at 101 325 Pa] |
density | 1.484[at 20℃] |
vapor pressure | 0Pa at 20℃ |
storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
solubility | H2O: 0.1 g/mL, clear |
pka | 1.88[at 20 ℃] |
form | solid |
Appearance | White to off-white Solid |
Water Solubility | 0.1 g/mL |
BRN | 3599287 |
InChI | InChI=1S/C6H5ClNO2S.Na/c7-8-11(9,10)6-4-2-1-3-5-6;/h1-5H;/q-1;+1 |
InChIKey | KDNCILYKSYKEFJ-UHFFFAOYSA-N |
SMILES | C1(=CC=CC=C1)S(=O)(=O)N(Cl)[Na] |
LogP | 0.14 at 26℃ |
EPA Substance Registry System | Chloramine B (127-52-6) |
content is empty!