 |
| White crystalline granules or white to grayish-white powder. Odorless. Slightly salty. Slightly hygroscopic. Stable in the air. Readily soluble in water. It is almost insoluble in ethanol. Chelating agent; Preservative; Antioxidants (used by chelation to prevent oxidation). It has the function of stabilizing product quality by combining free metals. It is used to eliminate the inhibition of enzymatic catalytic reactions caused by trace heavy metals | |||||||||
23411-34-9
bosschem
23411-34-9
| Calcium disodium edetate dihydrate Basic information | |
| Product Name: | Calcium disodium edetate dihydrate |
| CAS: | 23411-34-9 |
| MF: | C10H14CaN2NaO9- |
| MW: | 369.3 |
| EINECS: | 607-231-1 |
| Mol File: | 23411-34-9.mol |
| Calcium disodium edetate dihydrate Chemical Properties | |
| Melting point | >300°C |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly), Water |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic |
| Water Solubility | water: 1.6g/10 mL, clear, colorless to faintly yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H16N2O8.Ca.Na.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;1H2/q;+2;+1;/p-4 |
| InChIKey | MUBDSQWHVCAGNW-UHFFFAOYSA-J |
| SMILES | O=C1CN23CCN45CC(=O)[O-][Ca+2]24([O-]C(=O)C5)([O-]C(=O)C3)[O-]1.[Na+].O |
| LogP | -0.434 (est) |
| CAS DataBase Reference | 23411-34-9(CAS DataBase Reference) |
