| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Ammonium thioglycolate is an organic compound with the chemical formula HSCH₂CO₂NH₄, which can be used as a cold perm solution. | |||||||||
5421-46-5
Boss Chemical
5421-46-5
| Ammonium thioglycolate Basic information | |
| Product Name: | Ammonium thioglycolate |
| CAS: | 5421-46-5 |
| MF: | C2H7NO2S |
| MW: | 109.15 |
| EINECS: | 226-540-9 |
| Mol File: | 5421-46-5.mol |
| Ammonium thioglycolate Chemical Properties | |
| Melting point | 139-139.5 °C |
| Boiling point | 115℃[at 101 325 Pa] |
| density | 1.22 |
| vapor pressure | 0.001Pa at 25℃ |
| storage temp. | 2-8°C, stored under nitrogen |
| form | Solution |
| Specific Gravity | 1.245 (25℃) |
| color | Clear colorless |
| Odor | strong skunk-like odor |
| Water Solubility | Miscible |
| InChI | InChI=1S/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
| InChIKey | JYAVWXRMOOCSOD-UHFFFAOYSA-N |
| SMILES | C([O-])(=O)CS.[NH4+] |
| LogP | -2.99 at 20℃ |
| CAS DataBase Reference | 5421-46-5(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, 2-mercapto-, ammonium salt (1:1) (5421-46-5) |


content is empty!