| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Commonly used as film formers, dispersants, emulsifiers, thickeners, adhesives, flocculants, and complexing agents. | |||||||||
9011-16-9
Boss Chemical
9011-16-9
| Poly(methyl vinyl ether-alt-maleic anhydride) Basic information | |
| Product Name: | Poly(methyl vinyl ether-alt-maleic anhydride) |
| CAS: | 9011-16-9 |
| MF: | C7H8O4 |
| MW: | 156.14 |
| EINECS: | 241-473-5 |
| Mol File: | 9011-16-9.mol |
| Poly(methyl vinyl ether-alt-maleic anhydride) Chemical Properties | |
| density | 1.37 |
| solubility | several organic solvents and in water upon hydrolysis: soluble |
| form | powder |
| color | White |
| Water Solubility | H2O: soluble (upon hydrolysis) |
| organic solvents: soluble | |
| InChI | InChI=1S/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3-4-2/h1-2H;3H,1H2,2H3 |
| InChIKey | UPBDXRPQPOWRKR-UHFFFAOYSA-N |
| SMILES | C(=C)OC.O=C1C=CC(=O)O1 |
| CAS DataBase Reference | 9011-16-9(CAS DataBase Reference) |
| EPA Substance Registry System | Maleic anhydride methylvinyl ether polymer (9011-16-9) |


content is empty!