| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Tetramethoxymethyl glycoluril is a curing agent, which is produced by etherification of excess methanol with tetrahydroxymethyl glycoluril under acidic conditions, and distilled in the range of ra = 5-7 to separate volatile substances, and further hydroxymethylated and etherified to obtain tetramethoxymethyl glycoluril. | |||||||||
5395-50-6
bosschemical
5395-50-6
| Tetramethylol acetylenediurea Basic information | |
| Product Name: | Tetramethylol acetylenediurea |
| CAS: | 5395-50-6 |
| MF: | C8H14N4O6 |
| MW: | 262.22 |
| EINECS: | 226-408-0 |
| Mol File: | 5395-50-6.mol |
| Tetramethylol acetylenediurea Chemical Properties | |
| Melting point | 137-138 °C |
| Boiling point | 624.2±55.0 °C(Predicted) |
| density | 1.697±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 13.90±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H14N4O6/c13-1-9-5-6(11(3-15)7(9)17)12(4-16)8(18)10(5)2-14/h5-6,13-16H,1-4H2 |
| InChIKey | UUGLSEIATNSHRI-UHFFFAOYSA-N |
| SMILES | C(N1C(N(C2N(C(N(C21)CO)=O)CO)CO)=O)O |
| EPA Substance Registry System | Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4,6-tetrakis(hydroxymethyl)- (5395-50-6) |


content is empty!