| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Unlike its derivative 2,3-dichloro-1,4-naphthoquinone (which has bactericidal activity), the 2-chlorinated isomer is not directly used as a pesticide or dye, but is focused on the synthesis of high-value fine chemicals. | |||||||||
1010-60-2
bosschem
1010-60-2
2-Chloro-1,4-naphthoquinone Basic information | |
Product Name: | 2-Chloro-1,4-naphthoquinone |
CAS: | 1010-60-2 |
MF: | C10H5ClO2 |
MW: | 192.6 |
EINECS: | 213-776-2 |
Mol File: | 1010-60-2.mol |
2-Chloro-1,4-naphthoquinone Chemical Properties | |
Melting point | 108-109°C |
Boiling point | 308.0±42.0 °C(Predicted) |
density | 1.42±0.1 g/cm3(Predicted) |
storage temp. | Sealed in dry,2-8°C |
solubility | Chloroform (Slightly) |
form | Solid |
color | Yellow to Dark Yellow |
λmax | 333nm(Hexane)(lit.) |
Stability: | Moisture Sensitive |
InChI | InChI=1S/C10H5ClO2/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-5H |
InChIKey | CCTJHVLTAJTPBV-UHFFFAOYSA-N |
SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C=C1Cl |
CAS DataBase Reference | 1010-60-2(CAS DataBase Reference) |
NIST Chemistry Reference | 2-Chloro-1,4-naphthoquinone(1010-60-2) |
content is empty!