| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Lianku can be used as a flame-retardant enhancing agent for high molecular materials, as well as a catalyst or initiator for polymer cross-linking, graft copolymerization, and is widely applied in the modification of various high molecular materials such as polyolefins, polyacrylate, polycarbonate, and polyether. | |||||||||
1889-67-4
bosschem
1889-67-4
2,3-Dimethyl-2,3-diphenylbutane Basic information | |
Product Name: | 2,3-Dimethyl-2,3-diphenylbutane |
CAS: | 1889-67-4 |
MF: | C18H22 |
MW: | 238.37 |
EINECS: | 217-568-2 |
Mol File: | 1889-67-4.mol |
2,3-Dimethyl-2,3-diphenylbutane Chemical Properties | |
Melting point | 90-110 °C |
Boiling point | 335.97°C (estimate) |
density | 0.9859 (estimate) |
vapor pressure | 0.015Pa at 20℃ |
refractive index | 1.5413 (estimate) |
storage temp. | Sealed in dry,2-8°C |
form | Flakes, Crystalline Powder or Chunks |
color | White to light yellow |
Water Solubility | insoluble |
InChI | InChI=1S/C18H22/c1-17(2,15-11-7-5-8-12-15)18(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3 |
InChIKey | HGTUJZTUQFXBIH-UHFFFAOYSA-N |
SMILES | C(C1=CC=CC=C1)(C)(C)C(C1=CC=CC=C1)(C)C |
LogP | 6.68 at 25℃ |
NIST Chemistry Reference | Benzene, 1,1'-(1,1,2,2-tetramethyl-1,2-ethanediyl)bis-(1889-67-4) |
EPA Substance Registry System | 2,3-Dimethyl-2,3-diphenylbutane (1889-67-4) |
content is empty!