| Availability: | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| 1073-39-8 4-Bromobenzocyclobutene is an organic compound with the molecular formula C₈H₇Br, CAS number 1073-39-8, and molecular weight 183.04. Physical properties It is a colorless to light yellow liquid at room temperature, with a density of 1.6±0.1 g/cm³, a melting point of 94-97°C, a boiling point of 221.4±29.0°C (760 mmHg), and a flash point of 92.1±18.7°C. Chemical properties 4-Bromobenzocyclobutene can be used to synthesize a variety of dibenzocyclobutene monomers, which is an important raw material for resin synthesis. | |||||||||
1073-39-8
bosschemical
1073-39-8
| 4-Bromobenzocyclobutene Basic information | |
| Product Name: | 4-Bromobenzocyclobutene |
| CAS: | 1073-39-8 |
| MF: | C8H7Br |
| MW: | 183.05 |
| EINECS: | |
| Mol File: | 1073-39-8.mol |
| 4-Bromobenzocyclobutene Chemical Properties | |
| Boiling point | 118-119 °C(Press: 20 Torr) |
| density | 1.470 g/mL at 25 °C |
| refractive index | n20/D1.589 |
| Fp | 100℃ |
| storage temp. | 2-8°C |
| form | liquid |
| InChI | InChI=1S/C8H7Br/c9-8-4-3-6-1-2-7(6)5-8/h3-5H,1-2H2 |
| InChIKey | GMHHTGYHERDNLO-UHFFFAOYSA-N |
| SMILES | C12C(CC1)=CC=C(Br)C=2 |
| CAS DataBase Reference | 1073-39-8(CAS DataBase Reference) |


content is empty!